Bromocresol green
Cat.No:IB6680 Solarbio
CAS:76-60-8
Molecular Formula:C21H14Br4O5S
Molecular Weight:698.01
Storage:Powder:2-8℃,1 year
Purity:≥95%
Appearance:Off-white to light brown Solid
Qty:
Size:
{{cart_num}}
My CartCAS:76-60-8
Molecular Formula:C21H14Br4O5S
Molecular Weight:698.01
Storage:Powder:2-8℃,1 year
Purity:≥95%
Appearance:Off-white to light brown Solid
Qty:
Size:
| CAS | 76-60-8 |
| Name | Bromocresol green |
| Molecular Formula | C21H14Br4O5S |
| Molecular Weight | 698.01 |
| Solubility | Soluble in DMSO ≥10mg/mL(Need ultrasonic) |
| Purity | ≥95% |
| Appearance | Off-white to light brown Solid |
| Storage | Powder:2-8℃,1 year |
| EC | EINECS 200-972-8 |
| MDL | MFCD00005874 |
| SMILES | CC1=C(C(=C(C=C1C2(C3=CC=CC=C3S(=O)(=O)O2)C4=CC(=C(C(=C4C)Br)O)Br)Br)O)Br |
| InChIKey | FRPHFZCDPYBUAU-UHFFFAOYSA-N |
| InChI | InChI=1S/C21H14Br4O5S/c1-9-12(7-14(22)19(26)17(9)24)21(13-8-15(23)20(27)18(25)10(13)2)11-5-3-4-6-16(11)31(28,29)30-21/h3-8,26-27H,1-2H3 |
| PubChem CID | 6451 |
| Background | Bromocresol green is a ph-sensitive triphenylmethane dye commonly used to determine protein and serum albumin concentrations. Bromocresol green can be used as a pH indicator, appearing yellow-green to blue-green as pH increases from 3.0 to 7.5. Bromocresol green is also used to measure the concentration of molecules such as creatinine and to determine the survival rate of cells. |
| Unit | Bottle |
| Specification | 1g |
Remark:These protocols are for reference only. Solarbio does not independently validate these methods.
Note:
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download