{{cart_num}}
My CartCAS：56377-79-8
Molecular Formula：C51H43N13O12S6
Molecular Weight：1222.34
Storage：Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥98%
Appearance：Light yellow to yellow Solid
Qty：
Size：
| CAS | 56377-79-8 |
| Name | Nosiheptide |
| Molecular Formula | C51H43N13O12S6 |
| Molecular Weight | 1222.34 |
| Solubility | Soluble in DMSO ≥10mg/mL(Need ultrasonic) |
| Purity | ≥98% |
| Appearance | Light yellow to yellow Solid |
| Storage | Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| EC | EINECS 260-138-4 |
| MDL | MFCD00867479 |
| SMILES | C/C=C1/C2=NC(=CS2)C(=O)NC3CC(C(=O)OCC4=C5C(=C(C(=O)SCC(C6=NC(=CS6)C7=NC(=C(C=C7C8=NC(=CS8)C(=O)NC(C(=O)N1)C(C)O)O)C9=NC(=CS9)C(=O)NC(=C)C(=O)N)NC(=O)C1=CSC3=N1)NC5=CC=C4)C)O |
| InChIKey | OQAOHXRUMXWDLQ-FPQMYIDKSA-N |
| InChI | InChI=1S/C51H43N13O12S6/c1-5-23-46-60-28(14-79-46)41(70)56-25-10-33(67)50(74)76-11-21-7-6-8-24-34(21)18(2)35(54-24)51(75)82-17-31(57-42(71)29-15-80-47(25)61-29)48-58-26(12-78-48)37-22(45-59-30(13-77-45)43(72)64-36(20(4)65)44(73)55-23)9-32(66)38(63-37)49-62-27(16-81-49)40(69)53-19(3)39(52)68/h5-9，12-16，20，25，31，33，36，54，65-67H，3，10-11，17H2，1-2，4H3，(H2，52，68)(H，53，69)(H，55，73)(H，56，70)(H，57，71)(H，64，72)/b23-5- |
| PubChem CID | 16129696 |
| Target Point | Bacterial |
| Passage | Anti-infection |
| Background | Nosiheptide is a thiopeptide antibiotic that inhibits bacterial protein synthesis and has a unique indole-side ring system and region-specific hydroxyl group on a unique macrocyclic nucleus. |
| Unit | Bottle |
| Specification | 5mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
