Salinomycin
Cat.No:IS4300 Solarbio
CAS:53003-10-4
Molecular Formula:C42H70O11
Molecular Weight:751
Storage:Powder:2-8℃,2 years;Insolvent(Mother Liquid):-20℃,6 months;-80℃,1 year
Purity:≥98%
Appearance:White to light yellow Solid
Qty:
Size:
{{cart_num}}
My CartCAS:53003-10-4
Molecular Formula:C42H70O11
Molecular Weight:751
Storage:Powder:2-8℃,2 years;Insolvent(Mother Liquid):-20℃,6 months;-80℃,1 year
Purity:≥98%
Appearance:White to light yellow Solid
Qty:
Size:
| CAS | 53003-10-4 |
| Name | Salinomycin |
| Molecular Formula | C42H70O11 |
| Molecular Weight | 751 |
| Solubility | Soluble in DMSO ≥5mg/mL(Need ultrasonic) |
| Purity | ≥98% |
| Appearance | White to light yellow Solid |
| Storage | Powder:2-8℃,2 years;Insolvent(Mother Liquid):-20℃,6 months;-80℃,1 year |
| EC | EINECS 258-290-1 |
| MDL | MFCD25541652 |
| SMILES | CC[C@H]([C@H]1CC[C@@H]([C@@H](O1)[C@@H](C)[C@@H]([C@H](C)C(=O)[C@H](CC)[C@@H]2[C@H](C[C@H]([C@]3(O2)C=C[C@H]([C@@]4(O3)CC[C@@](O4)(C)[C@H]5CC[C@@]([C@@H](O5)C)(CC)O)O)C)C)O)C)C(=O)O |
| InChIKey | KQXDHUJYNAXLNZ-XQSDOZFQSA-N |
| InChI | InChI=1S/C42H70O11/c1-11-29(38(46)47)31-15-14-23(4)36(50-31)27(8)34(44)26(7)35(45)30(12-2)37-24(5)22-25(6)41(51-37)19-16-32(43)42(53-41)21-20-39(10,52-42)33-17-18-40(48,13-3)28(9)49-33/h16,19,23-34,36-37,43-44,48H,11-15,17-18,20-22H2,1-10H3,(H,46,47)/t23-,24-,25+,26-,27-,28-,29+,30-,31+,32+,33+,34+,36+,37-,39-,40+,41-,42-/m0/s1 |
| PubChem CID | 3085092 |
| Target Point | Bacterial;Wnt/β-catenin |
| Passage | Anti-infection |
| Background | Salinomycin is a potassium ion carrier antibiotic that selectively inhibits the growth of gram-positive bacteria. Salinomycin was also a potent inhibitor of Wnt/ beta-catenin signaling, blocking WNT-induced phosphorylation of LRP6. |
| Unit | Bottle |
| Specification | 5mg |
Remark:These protocols are for reference only. Solarbio does not independently validate these methods.
Note:
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download