iKIX1
Cat.No:II2720 Solarbio
CAS:656222-54-7
Molecular Formula:C10H8Cl2N4OS
Molecular Weight:303.16
Storage:Powder:2-8℃,2 years;Insolvent(Mother Liquid):-20℃,6 months;-80℃,1 year
Purity:≥98%
Appearance:Off-white to light yellow Solid
Qty:
Size:
{{cart_num}}
My CartCAS:656222-54-7
Molecular Formula:C10H8Cl2N4OS
Molecular Weight:303.16
Storage:Powder:2-8℃,2 years;Insolvent(Mother Liquid):-20℃,6 months;-80℃,1 year
Purity:≥98%
Appearance:Off-white to light yellow Solid
Qty:
Size:
| CAS | 656222-54-7 |
| Name | iKIX1 |
| Molecular Formula | C10H8Cl2N4OS |
| Molecular Weight | 303.16 |
| Solubility | Soluble in DMSO ≥5mg/mL |
| Purity | ≥98% |
| Appearance | Off-white to light yellow Solid |
| Storage | Powder:2-8℃,2 years;Insolvent(Mother Liquid):-20℃,6 months;-80℃,1 year |
| MDL | MFCD00119122 |
| SMILES | C1=CC(=C(C=C1NC(=S)NNC(=O)CC#N)Cl)Cl |
| InChIKey | XKQJVBSDCOCZFV-UHFFFAOYSA-N |
| InChI | InChI=1S/C10H8Cl2N4OS/c11-7-2-1-6(5-8(7)12)14-10(18)16-15-9(17)3-4-13/h1-2,5H,3H2,(H,15,17)(H2,14,16,18) |
| PubChem CID | 2803648 |
| Target Point | Fungal |
| Passage | Anti-infection |
| Background | iKIX1 is an antifungal compound. iKIX1 inhibits the interaction between the KIX domain of the subunit CgGal11A and the activation domain of CgPdr1, which can be used to study multidrug resistance and Candida glabra infection. |
| Unit | Bottle |
| Specification | 5mg |
Remark:These protocols are for reference only. Solarbio does not independently validate these methods.
Note:
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download