{{cart_num}}
My CartCAS：18942-26-2
Molecular Formula：C41H32O27
Molecular Weight：956.68
Storage：Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：HPLC≥95%
Appearance：White to off-white Solid
Qty：
Size：
| CAS | 18942-26-2 |
| Name | Chebulinic Acid |
| Molecular Formula | C41H32O27 |
| Molecular Weight | 956.68 |
| Solubility | Soluble in DMSO ≥10mg/mL(Need ultrasonic) |
| Purity | HPLC≥95% |
| Appearance | White to off-white Solid |
| Storage | Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| MDL | MFCD06656295 |
| SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C3C(C(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C6=C5C(C(C(=O)O3)CC(=O)O)C(C(=O)O6)O)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O |
| InChIKey | YGVHOSGNOYKRIH-FJPMMHPYSA-N |
| InChI | InChI=1S/C41H32O27/c42-15-1-10(2-16(43)26(15)51)35(56)62-9-22-31-33(66-36(57)11-3-17(44)27(52)18(45)4-11)34(41(63-22)68-37(58)12-5-19(46)28(53)20(47)6-12)67-38(59)13-7-21(48)29(54)32-25(13)24(30(55)40(61)65-32)14(8-23(49)50)39(60)64-31/h1-7，14，22，24，30-31，33-34，41-48，51-55H，8-9H2，(H，49，50)/t14-，22+，24-，30-，31+，33-，34+，41-/m0/s1 |
| PubChem CID | 72284 |
| Target Point | Influenza viral neuraminidase;VEGF |
| Passage | Anti-infection;Angiogenesis; Protein Tyrosine Kinase/RTK |
| Background | Chebulinic acid is an Influenza viral neuraminidase inhibitor. Chebulinic acid is also an antiangiogenic agent that acts by inhibiting VEGF. Chebulinic acid has antitumor activity. |
| Unit | Bottle |
| Specification | 5mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
