{{cart_num}}
My CartCAS：1352879-65-2
Molecular Formula：C27H27N3O2
Molecular Weight：425.52
Storage：Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year
Purity：≥98%
Appearance：White to off-white Solid
Qty：
Size：
| CAS | 1352879-65-2 |
| Name | PF-3450074 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.52 |
| Solubility | Soluble in DMSO |
| Purity | ≥98% |
| Appearance | White to off-white Solid |
| Storage | Powder:2-8℃，2 years;Insolvent(Mother Liquid):-20℃，6 months;-80℃，1 year |
| MDL | MFCD28160729 |
| SMILES | CC1=C(C2=CC=CC=C2N1)CC(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N(C)C4=CC=CC=C4 |
| InChIKey | ACDFWSNAQWFRRF-VWLOTQADSA-N |
| InChI | InChI=1S/C27H27N3O2/c1-19-23(22-15-9-10-16-24(22)28-19)18-26(31)29-25(17-20-11-5-3-6-12-20)27(32)30(2)21-13-7-4-8-14-21/h3-16，25，28H，17-18H2，1-2H3，(H，29，31)/t25-/m0/s1 |
| PubChem CID | 49800090 |
| Target Point | HIV-1 |
| Passage | Anti-infection |
| Background | PF-3450074 is a specific inhibitor of HIV-1 capsid protein (CA) that acts in the early stages of HIV-1 infection by directly competing with CPSF6 and NUP153 binding to inhibit viral replication and block the demembrane， assembly， and reverse transcription steps of the viral life cycle. |
| Unit | Bottle |
| Specification | 5mg |
Remark：These protocols are for reference only. Solarbio does not independently validate these methods.
Note：
1. The products are all for scientific research use only. Do not use it for medical, clinical diagnosis or treatment, food and cosmetics, etc. Do not store them in ordinary residential areas.
2. For your safety and health, please wear laboratory clothes, disposable gloves and masks.
3. The experimental results may be affected by many factors, after-sale service is limited to the product itself and does not involve other compensation.
Sorry, there is no more information.
Sorry, there is no more information.
Manual Download
